C27H44OS — CID 143129254
ethane;1-hexoxypropan-2-ylbenzene;1-methylsulfanyl-2-propylbenzene (PubChem CID 143129254) has the molecular formula C27H44OS and a molecular weight of 416.72 g/mol. Its IUPAC name is ethane;1-hexoxypropan-2-ylbenzene;1-methylsulfanyl-2-propylbenzene.
| Compound Name | ethane;1-hexoxypropan-2-ylbenzene;1-methylsulfanyl-2-propylbenzene |
|---|---|
| PubChem CID | 143129254 |
| Molecular Formula | C27H44OS |
| Molecular Weight | 416.72 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | ethane;1-hexoxypropan-2-ylbenzene;1-methylsulfanyl-2-propylbenzene |
| SMILES | CC.CCCCCCOCC(C)c1ccccc1.CCCc1ccccc1SC |
| InChI | InChI=1S/C15H24O.C10H14S.C2H6/c1-3-4-5-9-12-16-13-14(2)15-10-7-6-8-11-15;1-3-6-9-7-4-5-8-10(9)11-2;1-2/h6-8,10-11,14H,3-5,9,12-13H2,1-2H3;4-5,7-8H,3,6H2,1-2H3;1-2H3 |
| InChIKey | BZQLCONSRIYIBJ-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.72 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|