C21H31N3O4S — CID 143129458
ethane;2-[4-methyl-2-[[(2S)-2-[4-(2-methylpropyl)phenyl]propanoyl]amino]-1,3-thiazol-5-yl]ethyl nitrate (PubChem CID 143129458) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is ethane;2-[4-methyl-2-[[(2S)-2-[4-(2-methylpropyl)phenyl]propanoyl]amino]-1,3-thiazol-5-yl]ethyl nitrate.
| Compound Name | ethane;2-[4-methyl-2-[[(2S)-2-[4-(2-methylpropyl)phenyl]propanoyl]amino]-1,3-thiazol-5-yl]ethyl nitrate |
|---|---|
| PubChem CID | 143129458 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | ethane;2-[4-methyl-2-[[(2S)-2-[4-(2-methylpropyl)phenyl]propanoyl]amino]-1,3-thiazol-5-yl]ethyl nitrate |
| SMILES | CC.Cc1nc(NC(=O)[C@@H](C)c2ccc(CC(C)C)cc2)sc1CCO[N+](=O)[O-] |
| InChI | InChI=1S/C19H25N3O4S.C2H6/c1-12(2)11-15-5-7-16(8-6-15)13(3)18(23)21-19-20-14(4)17(27-19)9-10-26-22(24)25;1-2/h5-8,12-13H,9-11H2,1-4H3,(H,20,21,23);1-2H3/t13-;/m0./s1 |
| InChIKey | IVSNTRVSKPJWNC-ZOWNYOTGSA-N |
| XLogP | 5.17 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|