C8H12N4O — CID 143129766
2,3-dimethyl-5,6,7,8-tetrahydropteridin-4-one (PubChem CID 143129766) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 2,3-dimethyl-5,6,7,8-tetrahydropteridin-4-one.
| Compound Name | 2,3-dimethyl-5,6,7,8-tetrahydropteridin-4-one |
|---|---|
| PubChem CID | 143129766 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 2,3-dimethyl-5,6,7,8-tetrahydropteridin-4-one |
| SMILES | Cc1nc2c(c(=O)n1C)NCCN2 |
| InChI | InChI=1S/C8H12N4O/c1-5-11-7-6(8(13)12(5)2)9-3-4-10-7/h9-10H,3-4H2,1-2H3 |
| InChIKey | QPTHPVOVLDIBDZ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |