C12H20N2O — CID 143129912
(3aR,4S,9bR)-4-methyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline;molecular hydrogen;hydrate (PubChem CID 143129912) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is (3aR,4S,9bR)-4-methyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline;molecular hydrogen;hydrate.
| Compound Name | (3aR,4S,9bR)-4-methyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline;molecular hydrogen;hydrate |
|---|---|
| PubChem CID | 143129912 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (3aR,4S,9bR)-4-methyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline;molecular hydrogen;hydrate |
| SMILES | C[C@@H]1Nc2ccccc2[C@@H]2NCC[C@H]12.O.[H][H] |
| InChI | InChI=1S/C12H16N2.H2O.H2/c1-8-9-6-7-13-12(9)10-4-2-3-5-11(10)14-8;;/h2-5,8-9,12-14H,6-7H2,1H3;1H2;1H/t8-,9+,12+;;/m0../s1 |
| InChIKey | CTAOKAVCEOQKDK-OVPMVTQVSA-N |
| XLogP | 1.57 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |