About ethane;4-ethylmorpholine;4-(3-methyl-6-morpholin-4-ylhexyl)morpholine
ethane;4-ethylmorpholine;4-(3-methyl-6-morpholin-4-ylhexyl)morpholine (PubChem CID 143130099) has the molecular formula C23H49N3O3
and a molecular weight of 415.66 g/mol. Its IUPAC name is ethane;4-ethylmorpholine;4-(3-methyl-6-morpholin-4-ylhexyl)morpholine.
Molecular Properties
| Compound Name | ethane;4-ethylmorpholine;4-(3-methyl-6-morpholin-4-ylhexyl)morpholine |
| PubChem CID | 143130099 |
| Molecular Formula | C23H49N3O3 |
| Molecular Weight | 415.66 g/mol |
| Exact Mass | 415.38 |
| IUPAC Name | ethane;4-ethylmorpholine;4-(3-methyl-6-morpholin-4-ylhexyl)morpholine |
| SMILES | CC.CC(CCCN1CCOCC1)CCN1CCOCC1.CCN1CCOCC1 |
| InChI | InChI=1S/C15H30N2O2.C6H13NO.C2H6/c1-15(4-6-17-9-13-19-14-10-17)3-2-5-16-7-11-18-12-8-16;1-2-7-3-5-8-6-4-7;1-2/h15H,2-14H2,1H3;2-6H2,1H3;1-2H3 |
| InChIKey | HKNWBJIZPYDKTP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.66 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;4-ethylmorpholine;4-(3-methyl-6-morpholin-4-ylhexyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethylmorpholine;4-(3-methyl-6-morpholin-4-ylhexyl)morpholine?
The IUPAC name of ethane;4-ethylmorpholine;4-(3-methyl-6-morpholin-4-ylhexyl)morpholine (CID 143130099) is ethane;4-ethylmorpholine;4-(3-methyl-6-morpholin-4-ylhexyl)morpholine.
What is the SMILES notation for ethane;4-ethylmorpholine;4-(3-methyl-6-morpholin-4-ylhexyl)morpholine?
The canonical SMILES for ethane;4-ethylmorpholine;4-(3-methyl-6-morpholin-4-ylhexyl)morpholine is CC.CC(CCCN1CCOCC1)CCN1CCOCC1.CCN1CCOCC1.
What is the InChIKey of ethane;4-ethylmorpholine;4-(3-methyl-6-morpholin-4-ylhexyl)morpholine?
The InChIKey is HKNWBJIZPYDKTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O2.C6H13NO.C2H6/c1-15(4-6-17-9-13-19-14-10-17)3-2-5-16-7-11-18-12-8-16;1-2-7-3-5-8-6-4-7;1-2/h15H,2-14H2,1H3;2-6H2,1H3;1-2H3.
What are the key properties of ethane;4-ethylmorpholine;4-(3-methyl-6-morpholin-4-ylhexyl)morpholine?
ethane;4-ethylmorpholine;4-(3-methyl-6-morpholin-4-ylhexyl)morpholine has a molecular weight of 415.66 g/mol, XLogP of 2.82, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethylmorpholine;4-(3-methyl-6-morpholin-4-ylhexyl)morpholine is sourced from PubChem (CID 143130099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).