About 4-(4-methylcyclohexa-1,3-dien-1-yl)-1,2,4-triazole
4-(4-methylcyclohexa-1,3-dien-1-yl)-1,2,4-triazole (PubChem CID 143130125) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 4-(4-methylcyclohexa-1,3-dien-1-yl)-1,2,4-triazole.
Analyze 4-(4-methylcyclohexa-1,3-dien-1-yl)-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylcyclohexa-1,3-dien-1-yl)-1,2,4-triazole?
The IUPAC name of 4-(4-methylcyclohexa-1,3-dien-1-yl)-1,2,4-triazole (CID 143130125) is 4-(4-methylcyclohexa-1,3-dien-1-yl)-1,2,4-triazole.
What is the SMILES notation for 4-(4-methylcyclohexa-1,3-dien-1-yl)-1,2,4-triazole?
The canonical SMILES for 4-(4-methylcyclohexa-1,3-dien-1-yl)-1,2,4-triazole is CC1=CC=C(n2cnnc2)CC1.
What is the InChIKey of 4-(4-methylcyclohexa-1,3-dien-1-yl)-1,2,4-triazole?
The InChIKey is ZCBAJZVAUQQDSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c1-8-2-4-9(5-3-8)12-6-10-11-7-12/h2,4,6-7H,3,5H2,1H3.
What are the key properties of 4-(4-methylcyclohexa-1,3-dien-1-yl)-1,2,4-triazole?
4-(4-methylcyclohexa-1,3-dien-1-yl)-1,2,4-triazole has a molecular weight of 161.21 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylcyclohexa-1,3-dien-1-yl)-1,2,4-triazole is sourced from PubChem (CID 143130125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).