C23H38N6O3 — CID 143131043
6-[1-(cyclopentylamino)-1-hydroxyethyl]-5,6-dimethyl-4-oxo-N-(3-pyrrolidin-1-ylpropyl)-7H-pyrazolo[1,5-a]pyrazine-2-carboxamide (PubChem CID 143131043) has the molecular formula C23H38N6O3 and a molecular weight of 446.60 g/mol. Its IUPAC name is 6-[1-(cyclopentylamino)-1-hydroxyethyl]-5,6-dimethyl-4-oxo-N-(3-pyrrolidin-1-ylpropyl)-7H-pyrazolo[1,5-a]pyrazine-2-carboxamide.
| Compound Name | 6-[1-(cyclopentylamino)-1-hydroxyethyl]-5,6-dimethyl-4-oxo-N-(3-pyrrolidin-1-ylpropyl)-7H-pyrazolo[1,5-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 143131043 |
| Molecular Formula | C23H38N6O3 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | 6-[1-(cyclopentylamino)-1-hydroxyethyl]-5,6-dimethyl-4-oxo-N-(3-pyrrolidin-1-ylpropyl)-7H-pyrazolo[1,5-a]pyrazine-2-carboxamide |
| SMILES | CN1C(=O)c2cc(C(=O)NCCCN3CCCC3)nn2CC1(C)C(C)(O)NC1CCCC1 |
| InChI | InChI=1S/C23H38N6O3/c1-22(23(2,32)25-17-9-4-5-10-17)16-29-19(21(31)27(22)3)15-18(26-29)20(30)24-11-8-14-28-12-6-7-13-28/h15,17,25,32H,4-14,16H2,1-3H3,(H,24,30) |
| InChIKey | OIDKAHGPSCDUOL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|