C31H35N3O2S — CID 143131183
10-benzyl-N-cyclooctyl-11-[(3E)-hexa-1,3,5-trien-3-yl]-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 143131183) has the molecular formula C31H35N3O2S and a molecular weight of 513.71 g/mol. Its IUPAC name is 10-benzyl-N-cyclooctyl-11-[(3E)-hexa-1,3,5-trien-3-yl]-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | 10-benzyl-N-cyclooctyl-11-[(3E)-hexa-1,3,5-trien-3-yl]-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 143131183 |
| Molecular Formula | C31H35N3O2S |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 10-benzyl-N-cyclooctyl-11-[(3E)-hexa-1,3,5-trien-3-yl]-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | C=C/C=C(\C=C)C1(C(=O)NC2CCCCCCC2)Cn2c(cc3sccc32)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C31H35N3O2S/c1-3-13-24(4-2)31(30(36)32-25-16-11-6-5-7-12-17-25)22-33-26-18-19-37-28(26)20-27(33)29(35)34(31)21-23-14-9-8-10-15-23/h3-4,8-10,13-15,18-20,25H,1-2,5-7,11-12,16-17,21-22H2,(H,32,36)/b24-13+ |
| InChIKey | AKOAWXNUKKMKTL-ZMOGYAJESA-N |
| XLogP | 6.63 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|