C26H29ClN4O3 — CID 143131199
6-chloro-N-cyclohexyl-2-(4-ethylphenyl)-5-(furan-2-ylmethyl)-4-oxo-7H-pyrazolo[1,5-a]pyrazine-6-carboxamide (PubChem CID 143131199) has the molecular formula C26H29ClN4O3 and a molecular weight of 481.00 g/mol. Its IUPAC name is 6-chloro-N-cyclohexyl-2-(4-ethylphenyl)-5-(furan-2-ylmethyl)-4-oxo-7H-pyrazolo[1,5-a]pyrazine-6-carboxamide.
| Compound Name | 6-chloro-N-cyclohexyl-2-(4-ethylphenyl)-5-(furan-2-ylmethyl)-4-oxo-7H-pyrazolo[1,5-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 143131199 |
| Molecular Formula | C26H29ClN4O3 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 6-chloro-N-cyclohexyl-2-(4-ethylphenyl)-5-(furan-2-ylmethyl)-4-oxo-7H-pyrazolo[1,5-a]pyrazine-6-carboxamide |
| SMILES | CCc1ccc(-c2cc3n(n2)CC(Cl)(C(=O)NC2CCCCC2)N(Cc2ccco2)C3=O)cc1 |
| InChI | InChI=1S/C26H29ClN4O3/c1-2-18-10-12-19(13-11-18)22-15-23-24(32)30(16-21-9-6-14-34-21)26(27,17-31(23)29-22)25(33)28-20-7-4-3-5-8-20/h6,9-15,20H,2-5,7-8,16-17H2,1H3,(H,28,33) |
| InChIKey | HZQCGQFLIVHAEY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|