C26H22FN3O3S — CID 143131205
4-(3-fluorophenyl)-N-[(2-hydroxyphenyl)methyl]-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide (PubChem CID 143131205) has the molecular formula C26H22FN3O3S and a molecular weight of 475.55 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-N-[(2-hydroxyphenyl)methyl]-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide.
| Compound Name | 4-(3-fluorophenyl)-N-[(2-hydroxyphenyl)methyl]-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide |
|---|---|
| PubChem CID | 143131205 |
| Molecular Formula | C26H22FN3O3S |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 4-(3-fluorophenyl)-N-[(2-hydroxyphenyl)methyl]-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide |
| SMILES | Cn1c2c(c3ccccc31)C(C(=O)NCc1ccccc1O)N(c1cccc(F)c1)C(=O)CS2 |
| InChI | InChI=1S/C26H22FN3O3S/c1-29-20-11-4-3-10-19(20)23-24(25(33)28-14-16-7-2-5-12-21(16)31)30(22(32)15-34-26(23)29)18-9-6-8-17(27)13-18/h2-13,24,31H,14-15H2,1H3,(H,28,33) |
| InChIKey | VDVPDMYLQXMFCV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|