C28H29N3O3S — CID 143131214
N-benzyl-4-[(2Z)-2-ethenyl-3-methoxypenta-2,4-dienyl]-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide (PubChem CID 143131214) has the molecular formula C28H29N3O3S and a molecular weight of 487.63 g/mol. Its IUPAC name is N-benzyl-4-[(2Z)-2-ethenyl-3-methoxypenta-2,4-dienyl]-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide.
| Compound Name | N-benzyl-4-[(2Z)-2-ethenyl-3-methoxypenta-2,4-dienyl]-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide |
|---|---|
| PubChem CID | 143131214 |
| Molecular Formula | C28H29N3O3S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | N-benzyl-4-[(2Z)-2-ethenyl-3-methoxypenta-2,4-dienyl]-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide |
| SMILES | C=C/C(CN1C(=O)CSc2c(c3ccccc3n2C)C1C(=O)NCc1ccccc1)=C(\C=C)OC |
| InChI | InChI=1S/C28H29N3O3S/c1-5-20(23(6-2)34-4)17-31-24(32)18-35-28-25(21-14-10-11-15-22(21)30(28)3)26(31)27(33)29-16-19-12-8-7-9-13-19/h5-15,26H,1-2,16-18H2,3-4H3,(H,29,33)/b23-20- |
| InChIKey | ZAVHXLRUIRWTEN-ATJXCDBQSA-N |
| XLogP | 4.74 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|