C17H17N5OS — CID 143131572
N'-amino-3-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1,3-thiazol-2-yl]-2-hydroxy-1H-indole-5-carboximidamide (PubChem CID 143131572) has the molecular formula C17H17N5OS and a molecular weight of 339.42 g/mol. Its IUPAC name is N'-amino-3-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1,3-thiazol-2-yl]-2-hydroxy-1H-indole-5-carboximidamide.
| Compound Name | N'-amino-3-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1,3-thiazol-2-yl]-2-hydroxy-1H-indole-5-carboximidamide |
|---|---|
| PubChem CID | 143131572 |
| Molecular Formula | C17H17N5OS |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N'-amino-3-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1,3-thiazol-2-yl]-2-hydroxy-1H-indole-5-carboximidamide |
| SMILES | C=C/C=C\c1nc(-c2c(O)[nH]c3ccc(/C(N)=N/N)cc23)sc1C |
| InChI | InChI=1S/C17H17N5OS/c1-3-4-5-12-9(2)24-17(21-12)14-11-8-10(15(18)22-19)6-7-13(11)20-16(14)23/h3-8,20,23H,1,19H2,2H3,(H2,18,22)/b5-4- |
| InChIKey | GDMKMOYFNKHETQ-PLNGDYQASA-N |
| XLogP | 3.08 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|