C16H15ClFN5O — CID 143132048
2-(3-chloro-4-fluorophenyl)acetaldehyde;N-methyl-5-pyridin-4-yl-1H-1,2,4-triazol-3-amine (PubChem CID 143132048) has the molecular formula C16H15ClFN5O and a molecular weight of 347.78 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)acetaldehyde;N-methyl-5-pyridin-4-yl-1H-1,2,4-triazol-3-amine.
| Compound Name | 2-(3-chloro-4-fluorophenyl)acetaldehyde;N-methyl-5-pyridin-4-yl-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 143132048 |
| Molecular Formula | C16H15ClFN5O |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)acetaldehyde;N-methyl-5-pyridin-4-yl-1H-1,2,4-triazol-3-amine |
| SMILES | CNc1n[nH]c(-c2ccncc2)n1.O=CCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C8H6ClFO.C8H9N5/c9-7-5-6(3-4-11)1-2-8(7)10;1-9-8-11-7(12-13-8)6-2-4-10-5-3-6/h1-2,4-5H,3H2;2-5H,1H3,(H2,9,11,12,13) |
| InChIKey | VBEJLTZCKZLYRX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|