C29H36Cl2F3NO2 — CID 143132605
2-[(6S)-3-(2,4-dichlorophenyl)-6-ethyl-1-[(1R)-1-[4-(trifluoromethyl)cyclohexyl]butyl]-4,5,6,7-tetrahydroindol-7-yl]acetic acid (PubChem CID 143132605) has the molecular formula C29H36Cl2F3NO2 and a molecular weight of 558.51 g/mol. Its IUPAC name is 2-[(6S)-3-(2,4-dichlorophenyl)-6-ethyl-1-[(1R)-1-[4-(trifluoromethyl)cyclohexyl]butyl]-4,5,6,7-tetrahydroindol-7-yl]acetic acid.
| Compound Name | 2-[(6S)-3-(2,4-dichlorophenyl)-6-ethyl-1-[(1R)-1-[4-(trifluoromethyl)cyclohexyl]butyl]-4,5,6,7-tetrahydroindol-7-yl]acetic acid |
|---|---|
| PubChem CID | 143132605 |
| Molecular Formula | C29H36Cl2F3NO2 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | 2-[(6S)-3-(2,4-dichlorophenyl)-6-ethyl-1-[(1R)-1-[4-(trifluoromethyl)cyclohexyl]butyl]-4,5,6,7-tetrahydroindol-7-yl]acetic acid |
| SMILES | CCC[C@H](C1CCC(C(F)(F)F)CC1)n1cc(-c2ccc(Cl)cc2Cl)c2c1C(CC(=O)O)[C@@H](CC)CC2 |
| InChI | InChI=1S/C29H36Cl2F3NO2/c1-3-5-26(18-6-9-19(10-7-18)29(32,33)34)35-16-24(21-13-11-20(30)14-25(21)31)22-12-8-17(4-2)23(28(22)35)15-27(36)37/h11,13-14,16-19,23,26H,3-10,12,15H2,1-2H3,(H,36,37)/t17-,18?,19?,23?,26+/m0/s1 |
| InChIKey | NZBLGSZBKPDJTH-DFWYCMISSA-N |
| XLogP | 9.70 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |