C17H28F2N2O — CID 143132847
5-(3,3-difluorobutylamino)-N-[(4-methylcyclohexa-1,3-dien-1-yl)methyl]pentanamide (PubChem CID 143132847) has the molecular formula C17H28F2N2O and a molecular weight of 314.42 g/mol. Its IUPAC name is 5-(3,3-difluorobutylamino)-N-[(4-methylcyclohexa-1,3-dien-1-yl)methyl]pentanamide.
| Compound Name | 5-(3,3-difluorobutylamino)-N-[(4-methylcyclohexa-1,3-dien-1-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 143132847 |
| Molecular Formula | C17H28F2N2O |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 5-(3,3-difluorobutylamino)-N-[(4-methylcyclohexa-1,3-dien-1-yl)methyl]pentanamide |
| SMILES | CC1=CC=C(CNC(=O)CCCCNCCC(C)(F)F)CC1 |
| InChI | InChI=1S/C17H28F2N2O/c1-14-6-8-15(9-7-14)13-21-16(22)5-3-4-11-20-12-10-17(2,18)19/h6,8,20H,3-5,7,9-13H2,1-2H3,(H,21,22) |
| InChIKey | KSFSBSCVPVHPKG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|