C33H30F3NO5S — CID 143133161
1-imino-1-[2-[2-[4-[1-methyl-6-(trifluoromethoxy)naphthalen-2-yl]phenyl]-2-oxoethyl]phenyl]sulfonylheptan-2-one (PubChem CID 143133161) has the molecular formula C33H30F3NO5S and a molecular weight of 609.67 g/mol. Its IUPAC name is 1-imino-1-[2-[2-[4-[1-methyl-6-(trifluoromethoxy)naphthalen-2-yl]phenyl]-2-oxoethyl]phenyl]sulfonylheptan-2-one.
| Compound Name | 1-imino-1-[2-[2-[4-[1-methyl-6-(trifluoromethoxy)naphthalen-2-yl]phenyl]-2-oxoethyl]phenyl]sulfonylheptan-2-one |
|---|---|
| PubChem CID | 143133161 |
| Molecular Formula | C33H30F3NO5S |
| Molecular Weight | 609.67 g/mol |
| Exact Mass | 609.18 |
| IUPAC Name | 1-imino-1-[2-[2-[4-[1-methyl-6-(trifluoromethoxy)naphthalen-2-yl]phenyl]-2-oxoethyl]phenyl]sulfonylheptan-2-one |
| SMILES | [H]/N=C(\C(=O)CCCCC)S(=O)(=O)c1ccccc1CC(=O)c1ccc(-c2ccc3cc(OC(F)(F)F)ccc3c2C)cc1 |
| InChI | InChI=1S/C33H30F3NO5S/c1-3-4-5-9-29(38)32(37)43(40,41)31-10-7-6-8-25(31)20-30(39)23-13-11-22(12-14-23)27-17-15-24-19-26(42-33(34,35)36)16-18-28(24)21(27)2/h6-8,10-19,37H,3-5,9,20H2,1-2H3/b37-32+ |
| InChIKey | FGDPGEWTOKERSI-BQNXFWFHSA-N |
| XLogP | 8.04 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.67 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|