C31H40F6N2 — CID 143133287
(3E,5E)-5-[7-[3,5-bis(trifluoromethyl)phenyl]-3-methyl-3,4,5,6-tetrahydroazepin-2-ylidene]-3-ethenyl-N-(3-methylidenehexyl)penta-1,3-dien-2-amine;ethane (PubChem CID 143133287) has the molecular formula C31H40F6N2 and a molecular weight of 554.66 g/mol. Its IUPAC name is (3E,5E)-5-[7-[3,5-bis(trifluoromethyl)phenyl]-3-methyl-3,4,5,6-tetrahydroazepin-2-ylidene]-3-ethenyl-N-(3-methylidenehexyl)penta-1,3-dien-2-amine;ethane.
| Compound Name | (3E,5E)-5-[7-[3,5-bis(trifluoromethyl)phenyl]-3-methyl-3,4,5,6-tetrahydroazepin-2-ylidene]-3-ethenyl-N-(3-methylidenehexyl)penta-1,3-dien-2-amine;ethane |
|---|---|
| PubChem CID | 143133287 |
| Molecular Formula | C31H40F6N2 |
| Molecular Weight | 554.66 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | (3E,5E)-5-[7-[3,5-bis(trifluoromethyl)phenyl]-3-methyl-3,4,5,6-tetrahydroazepin-2-ylidene]-3-ethenyl-N-(3-methylidenehexyl)penta-1,3-dien-2-amine;ethane |
| SMILES | C=C/C(=C\C=C1\N=C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCCC1C)C(=C)NCCC(=C)CCC.CC |
| InChI | InChI=1S/C29H34F6N2.C2H6/c1-6-9-19(3)14-15-36-21(5)22(7-2)12-13-26-20(4)10-8-11-27(37-26)23-16-24(28(30,31)32)18-25(17-23)29(33,34)35;1-2/h7,12-13,16-18,20,36H,2-3,5-6,8-11,14-15H2,1,4H3;1-2H3/b22-12+,26-13+; |
| InChIKey | SLCZOYOYSUSTAK-CUUOVSRASA-N |
| XLogP | 10.21 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.66 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|