C14H27IO3Si — CID 14313446
methyl (E,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodo-2,4-dimethylpent-4-enoate (PubChem CID 14313446) has the molecular formula C14H27IO3Si and a molecular weight of 398.36 g/mol. Its IUPAC name is methyl (E,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodo-2,4-dimethylpent-4-enoate.
| Compound Name | methyl (E,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodo-2,4-dimethylpent-4-enoate |
|---|---|
| PubChem CID | 14313446 |
| Molecular Formula | C14H27IO3Si |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | methyl (E,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodo-2,4-dimethylpent-4-enoate |
| SMILES | COC(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/I |
| InChI | InChI=1S/C14H27IO3Si/c1-10(9-15)12(11(2)13(16)17-6)18-19(7,8)14(3,4)5/h9,11-12H,1-8H3/b10-9+/t11-,12+/m1/s1 |
| InChIKey | AIIUNKXNDIVPAZ-ZGFRAZBVSA-N |
| XLogP | 4.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|