About 5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane
5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane (PubChem CID 143134594) has the molecular formula C23H37NO
and a molecular weight of 343.56 g/mol. Its IUPAC name is 5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane.
Molecular Properties
| Compound Name | 5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane |
| PubChem CID | 143134594 |
| Molecular Formula | C23H37NO |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.29 |
| IUPAC Name | 5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane |
| SMILES | C=C(C)C[C@H](C)CCC.CC(=O)c1ccc(C)c(C#N)c1.CC(C)C |
| InChI | InChI=1S/C10H9NO.C9H18.C4H10/c1-7-3-4-9(8(2)12)5-10(7)6-11;1-5-6-9(4)7-8(2)3;1-4(2)3/h3-5H,1-2H3;9H,2,5-7H2,1,3-4H3;4H,1-3H3/t;9-;/m.1./s1 |
| InChIKey | HCYJORFRWOCZQQ-IQPANZSWSA-N |
| XLogP | 7.12 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane?
The IUPAC name of 5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane (CID 143134594) is 5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane.
What is the SMILES notation for 5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane?
The canonical SMILES for 5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane is C=C(C)C[C@H](C)CCC.CC(=O)c1ccc(C)c(C#N)c1.CC(C)C.
What is the InChIKey of 5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane?
The InChIKey is HCYJORFRWOCZQQ-IQPANZSWSA-N. The full InChI is InChI=1S/C10H9NO.C9H18.C4H10/c1-7-3-4-9(8(2)12)5-10(7)6-11;1-5-6-9(4)7-8(2)3;1-4(2)3/h3-5H,1-2H3;9H,2,5-7H2,1,3-4H3;4H,1-3H3/t;9-;/m.1./s1.
What are the key properties of 5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane?
5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane has a molecular weight of 343.56 g/mol, XLogP of 7.12, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane is sourced from PubChem (CID 143134594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).