C23H37NO — CID 143134594
5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane (PubChem CID 143134594) has the molecular formula C23H37NO and a molecular weight of 343.56 g/mol. Its IUPAC name is 5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane.
| Compound Name | 5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane |
|---|---|
| PubChem CID | 143134594 |
| Molecular Formula | C23H37NO |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.29 |
| IUPAC Name | 5-acetyl-2-methylbenzonitrile;(4R)-2,4-dimethylhept-1-ene;2-methylpropane |
| SMILES | C=C(C)C[C@H](C)CCC.CC(=O)c1ccc(C)c(C#N)c1.CC(C)C |
| InChI | InChI=1S/C10H9NO.C9H18.C4H10/c1-7-3-4-9(8(2)12)5-10(7)6-11;1-5-6-9(4)7-8(2)3;1-4(2)3/h3-5H,1-2H3;9H,2,5-7H2,1,3-4H3;4H,1-3H3/t;9-;/m.1./s1 |
| InChIKey | HCYJORFRWOCZQQ-IQPANZSWSA-N |
| XLogP | 7.12 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|