About (3E,5Z)-3-ethylidene-7-prop-2-enoxyocta-5,7-dien-1-amine
(3E,5Z)-3-ethylidene-7-prop-2-enoxyocta-5,7-dien-1-amine (PubChem CID 143134686) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is (3E,5Z)-3-ethylidene-7-prop-2-enoxyocta-5,7-dien-1-amine.
Molecular Properties
| Compound Name | (3E,5Z)-3-ethylidene-7-prop-2-enoxyocta-5,7-dien-1-amine |
| PubChem CID | 143134686 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (3E,5Z)-3-ethylidene-7-prop-2-enoxyocta-5,7-dien-1-amine |
| SMILES | C=CCOC(=C)/C=C\C/C(=C\C)CCN |
| InChI | InChI=1S/C13H21NO/c1-4-11-15-12(3)7-6-8-13(5-2)9-10-14/h4-7H,1,3,8-11,14H2,2H3/b7-6-,13-5+ |
| InChIKey | AZEZLTABFLTVBO-ZQNRWWJISA-N |
| XLogP | 2.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5Z)-3-ethylidene-7-prop-2-enoxyocta-5,7-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5Z)-3-ethylidene-7-prop-2-enoxyocta-5,7-dien-1-amine?
The IUPAC name of (3E,5Z)-3-ethylidene-7-prop-2-enoxyocta-5,7-dien-1-amine (CID 143134686) is (3E,5Z)-3-ethylidene-7-prop-2-enoxyocta-5,7-dien-1-amine.
What is the SMILES notation for (3E,5Z)-3-ethylidene-7-prop-2-enoxyocta-5,7-dien-1-amine?
The canonical SMILES for (3E,5Z)-3-ethylidene-7-prop-2-enoxyocta-5,7-dien-1-amine is C=CCOC(=C)/C=C\C/C(=C\C)CCN.
What is the InChIKey of (3E,5Z)-3-ethylidene-7-prop-2-enoxyocta-5,7-dien-1-amine?
The InChIKey is AZEZLTABFLTVBO-ZQNRWWJISA-N. The full InChI is InChI=1S/C13H21NO/c1-4-11-15-12(3)7-6-8-13(5-2)9-10-14/h4-7H,1,3,8-11,14H2,2H3/b7-6-,13-5+.
What are the key properties of (3E,5Z)-3-ethylidene-7-prop-2-enoxyocta-5,7-dien-1-amine?
(3E,5Z)-3-ethylidene-7-prop-2-enoxyocta-5,7-dien-1-amine has a molecular weight of 207.32 g/mol, XLogP of 2.94, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5Z)-3-ethylidene-7-prop-2-enoxyocta-5,7-dien-1-amine is sourced from PubChem (CID 143134686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).