C30H50O3 — CID 14313580
4,4,6a,6b,8a,11,11,14b-octamethyl-2,3,4a,5,6,7,8,9,10,12,12a,14-dodecahydro-1H-picene-3,14,14a-triol (PubChem CID 14313580) has the molecular formula C30H50O3 and a molecular weight of 458.73 g/mol. Its IUPAC name is 4,4,6a,6b,8a,11,11,14b-octamethyl-2,3,4a,5,6,7,8,9,10,12,12a,14-dodecahydro-1H-picene-3,14,14a-triol.
| Compound Name | 4,4,6a,6b,8a,11,11,14b-octamethyl-2,3,4a,5,6,7,8,9,10,12,12a,14-dodecahydro-1H-picene-3,14,14a-triol |
|---|---|
| PubChem CID | 14313580 |
| Molecular Formula | C30H50O3 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 458.38 |
| IUPAC Name | 4,4,6a,6b,8a,11,11,14b-octamethyl-2,3,4a,5,6,7,8,9,10,12,12a,14-dodecahydro-1H-picene-3,14,14a-triol |
| SMILES | CC1(C)CCC2(C)CCC3(C)C(=CC(O)C4(O)C5(C)CCC(O)C(C)(C)C5CCC34C)C2C1 |
| InChI | InChI=1S/C30H50O3/c1-24(2)13-14-26(5)15-16-27(6)19(20(26)18-24)17-23(32)30(33)28(7)11-10-22(31)25(3,4)21(28)9-12-29(27,30)8/h17,20-23,31-33H,9-16,18H2,1-8H3 |
| InChIKey | VFENPYHEXWYISF-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|