C26H30N4O — CID 143135814
3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-[5-[(3-methylpiperidin-1-yl)methyl]-1H-indol-2-yl]-1H-pyridazin-6-one (PubChem CID 143135814) has the molecular formula C26H30N4O and a molecular weight of 414.55 g/mol. Its IUPAC name is 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-[5-[(3-methylpiperidin-1-yl)methyl]-1H-indol-2-yl]-1H-pyridazin-6-one.
| Compound Name | 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-[5-[(3-methylpiperidin-1-yl)methyl]-1H-indol-2-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 143135814 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-[5-[(3-methylpiperidin-1-yl)methyl]-1H-indol-2-yl]-1H-pyridazin-6-one |
| SMILES | C=C/C=C(\C=C/C)c1cc(-c2cc3cc(CN4CCCC(C)C4)ccc3[nH]2)c(=O)[nH]n1 |
| InChI | InChI=1S/C26H30N4O/c1-4-7-20(8-5-2)24-15-22(26(31)29-28-24)25-14-21-13-19(10-11-23(21)27-25)17-30-12-6-9-18(3)16-30/h4-5,7-8,10-11,13-15,18,27H,1,6,9,12,16-17H2,2-3H3,(H,29,31)/b8-5-,20-7+ |
| InChIKey | QAUCXNJDBBSJOT-HRAXFZPJSA-N |
| XLogP | 5.30 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|