C23H25N2OP — CID 143135818
5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[6-[methyl(propyl)amino]-1H-indol-2-yl]phosphol-2-one (PubChem CID 143135818) has the molecular formula C23H25N2OP and a molecular weight of 376.44 g/mol. Its IUPAC name is 5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[6-[methyl(propyl)amino]-1H-indol-2-yl]phosphol-2-one.
| Compound Name | 5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[6-[methyl(propyl)amino]-1H-indol-2-yl]phosphol-2-one |
|---|---|
| PubChem CID | 143135818 |
| Molecular Formula | C23H25N2OP |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[6-[methyl(propyl)amino]-1H-indol-2-yl]phosphol-2-one |
| SMILES | C=C/C=C(\C=C/C)C1=PC(=O)C(c2cc3ccc(N(C)CCC)cc3[nH]2)=C1 |
| InChI | InChI=1S/C23H25N2OP/c1-5-8-16(9-6-2)22-15-19(23(26)27-22)21-13-17-10-11-18(14-20(17)24-21)25(4)12-7-3/h5-6,8-11,13-15,24H,1,7,12H2,2-4H3/b9-6-,16-8+ |
| InChIKey | JRJZPLZJYFJTTE-LSYVIMNDSA-N |
| XLogP | 5.74 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|