About ethane;3-(methoxymethyl)-4-methylbenzoyl chloride
ethane;3-(methoxymethyl)-4-methylbenzoyl chloride (PubChem CID 143136390) has the molecular formula C14H23ClO2
and a molecular weight of 258.79 g/mol. Its IUPAC name is ethane;3-(methoxymethyl)-4-methylbenzoyl chloride.
Molecular Properties
| Compound Name | ethane;3-(methoxymethyl)-4-methylbenzoyl chloride |
| PubChem CID | 143136390 |
| Molecular Formula | C14H23ClO2 |
| Molecular Weight | 258.79 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | ethane;3-(methoxymethyl)-4-methylbenzoyl chloride |
| SMILES | CC.CC.COCc1cc(C(=O)Cl)ccc1C |
| InChI | InChI=1S/C10H11ClO2.2C2H6/c1-7-3-4-8(10(11)12)5-9(7)6-13-2;2*1-2/h3-5H,6H2,1-2H3;2*1-2H3 |
| InChIKey | HFXQMGNJNOFCGR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.79 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-(methoxymethyl)-4-methylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(methoxymethyl)-4-methylbenzoyl chloride?
The IUPAC name of ethane;3-(methoxymethyl)-4-methylbenzoyl chloride (CID 143136390) is ethane;3-(methoxymethyl)-4-methylbenzoyl chloride.
What is the SMILES notation for ethane;3-(methoxymethyl)-4-methylbenzoyl chloride?
The canonical SMILES for ethane;3-(methoxymethyl)-4-methylbenzoyl chloride is CC.CC.COCc1cc(C(=O)Cl)ccc1C.
What is the InChIKey of ethane;3-(methoxymethyl)-4-methylbenzoyl chloride?
The InChIKey is HFXQMGNJNOFCGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO2.2C2H6/c1-7-3-4-8(10(11)12)5-9(7)6-13-2;2*1-2/h3-5H,6H2,1-2H3;2*1-2H3.
What are the key properties of ethane;3-(methoxymethyl)-4-methylbenzoyl chloride?
ethane;3-(methoxymethyl)-4-methylbenzoyl chloride has a molecular weight of 258.79 g/mol, XLogP of 4.57, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(methoxymethyl)-4-methylbenzoyl chloride is sourced from PubChem (CID 143136390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).