C24H34O5 — CID 14313704
[(3R,3aS,5R,8aR)-3a-hydroxy-6,8a-dimethyl-3-propan-2-yl-1,2,3,4,5,8-hexahydroazulen-5-yl] 3,4-dimethoxybenzoate (PubChem CID 14313704) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is [(3R,3aS,5R,8aR)-3a-hydroxy-6,8a-dimethyl-3-propan-2-yl-1,2,3,4,5,8-hexahydroazulen-5-yl] 3,4-dimethoxybenzoate.
| Compound Name | [(3R,3aS,5R,8aR)-3a-hydroxy-6,8a-dimethyl-3-propan-2-yl-1,2,3,4,5,8-hexahydroazulen-5-yl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 14313704 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [(3R,3aS,5R,8aR)-3a-hydroxy-6,8a-dimethyl-3-propan-2-yl-1,2,3,4,5,8-hexahydroazulen-5-yl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@@H]2C[C@]3(O)[C@@H](C(C)C)CC[C@]3(C)CC=C2C)cc1OC |
| InChI | InChI=1S/C24H34O5/c1-15(2)18-10-12-23(4)11-9-16(3)21(14-24(18,23)26)29-22(25)17-7-8-19(27-5)20(13-17)28-6/h7-9,13,15,18,21,26H,10-12,14H2,1-6H3/t18-,21-,23+,24+/m1/s1 |
| InChIKey | FRTKCHBXZYXDGA-JIYUALFRSA-N |
| XLogP | 4.77 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|