C21H29F3N2O — CID 143137063
acetylene;[(1S,3R)-3-aminocyclopentyl]-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone;propane (PubChem CID 143137063) has the molecular formula C21H29F3N2O and a molecular weight of 382.47 g/mol. Its IUPAC name is acetylene;[(1S,3R)-3-aminocyclopentyl]-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone;propane.
| Compound Name | acetylene;[(1S,3R)-3-aminocyclopentyl]-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone;propane |
|---|---|
| PubChem CID | 143137063 |
| Molecular Formula | C21H29F3N2O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | acetylene;[(1S,3R)-3-aminocyclopentyl]-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone;propane |
| SMILES | C#C.CCC.N[C@@H]1CC[C@H](C(=O)N2CCc3ccc(C(F)(F)F)cc3C2)C1 |
| InChI | InChI=1S/C16H19F3N2O.C3H8.C2H2/c17-16(18,19)13-3-1-10-5-6-21(9-12(10)7-13)15(22)11-2-4-14(20)8-11;1-3-2;1-2/h1,3,7,11,14H,2,4-6,8-9,20H2;3H2,1-2H3;1-2H/t11-,14+;;/m0../s1 |
| InChIKey | RFRNCDPMBCNQCW-ODGKUACTSA-N |
| XLogP | 4.38 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|