C8H17NO3 — CID 143137102
methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide (PubChem CID 143137102) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide.
| Compound Name | methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide |
|---|---|
| PubChem CID | 143137102 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide |
| SMILES | C=CC[C@@H](C=O)NC(C)=O.CO.[H][H] |
| InChI | InChI=1S/C7H11NO2.CH4O.H2/c1-3-4-7(5-9)8-6(2)10;1-2;/h3,5,7H,1,4H2,2H3,(H,8,10);2H,1H3;1H/t7-;;/m0../s1 |
| InChIKey | DSGZBIKVJGEUQM-KLXURFKVSA-N |
| XLogP | 0.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|