About methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide
methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide (PubChem CID 143137102) has the molecular formula C8H17NO3
and a molecular weight of 175.23 g/mol. Its IUPAC name is methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide.
Molecular Properties
| Compound Name | methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide |
| PubChem CID | 143137102 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide |
| SMILES | C=CC[C@@H](C=O)NC(C)=O.CO.[H][H] |
| InChI | InChI=1S/C7H11NO2.CH4O.H2/c1-3-4-7(5-9)8-6(2)10;1-2;/h3,5,7H,1,4H2,2H3,(H,8,10);2H,1H3;1H/t7-;;/m0../s1 |
| InChIKey | DSGZBIKVJGEUQM-KLXURFKVSA-N |
| XLogP | 0.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide?
The IUPAC name of methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide (CID 143137102) is methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide.
What is the SMILES notation for methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide?
The canonical SMILES for methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide is C=CC[C@@H](C=O)NC(C)=O.CO.[H][H].
What is the InChIKey of methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide?
The InChIKey is DSGZBIKVJGEUQM-KLXURFKVSA-N. The full InChI is InChI=1S/C7H11NO2.CH4O.H2/c1-3-4-7(5-9)8-6(2)10;1-2;/h3,5,7H,1,4H2,2H3,(H,8,10);2H,1H3;1H/t7-;;/m0../s1.
What are the key properties of methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide?
methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide has a molecular weight of 175.23 g/mol, XLogP of 0.12, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;molecular hydrogen;N-[(2S)-1-oxopent-4-en-2-yl]acetamide is sourced from PubChem (CID 143137102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).