C15H27NO2S — CID 143137140
ethane;4-[(2E,4Z)-hepta-2,4,6-trienyl]-1-methylsulfonylpiperidine (PubChem CID 143137140) has the molecular formula C15H27NO2S and a molecular weight of 285.45 g/mol. Its IUPAC name is ethane;4-[(2E,4Z)-hepta-2,4,6-trienyl]-1-methylsulfonylpiperidine.
| Compound Name | ethane;4-[(2E,4Z)-hepta-2,4,6-trienyl]-1-methylsulfonylpiperidine |
|---|---|
| PubChem CID | 143137140 |
| Molecular Formula | C15H27NO2S |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | ethane;4-[(2E,4Z)-hepta-2,4,6-trienyl]-1-methylsulfonylpiperidine |
| SMILES | C=C/C=C\C=C\CC1CCN(S(C)(=O)=O)CC1.CC |
| InChI | InChI=1S/C13H21NO2S.C2H6/c1-3-4-5-6-7-8-13-9-11-14(12-10-13)17(2,15)16;1-2/h3-7,13H,1,8-12H2,2H3;1-2H3/b5-4-,7-6+; |
| InChIKey | HFDNWSOUBNNRRX-YLKXMWBMSA-N |
| XLogP | 3.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|