C14H18O7 — CID 14313806
dimethyl (1S,4S,5S)-7,7-dimethoxy-8-oxobicyclo[2.2.2]oct-2-ene-2,5-dicarboxylate (PubChem CID 14313806) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is dimethyl (1S,4S,5S)-7,7-dimethoxy-8-oxobicyclo[2.2.2]oct-2-ene-2,5-dicarboxylate.
| Compound Name | dimethyl (1S,4S,5S)-7,7-dimethoxy-8-oxobicyclo[2.2.2]oct-2-ene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 14313806 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | dimethyl (1S,4S,5S)-7,7-dimethoxy-8-oxobicyclo[2.2.2]oct-2-ene-2,5-dicarboxylate |
| SMILES | COC(=O)C1=C[C@@H]2C(=O)C(OC)(OC)[C@H]1C[C@@H]2C(=O)OC |
| InChI | InChI=1S/C14H18O7/c1-18-12(16)8-6-10-9(13(17)19-2)5-7(8)11(15)14(10,20-3)21-4/h5,7-8,10H,6H2,1-4H3/t7-,8-,10-/m0/s1 |
| InChIKey | DURSYYLRXWRGAQ-NRPADANISA-N |
| XLogP | 0.08 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|