C22H17F2N2O4PS — CID 143138142
2,2-difluoro-2-phosphanylacetic acid;4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carboxylic acid (PubChem CID 143138142) has the molecular formula C22H17F2N2O4PS and a molecular weight of 474.43 g/mol. Its IUPAC name is 2,2-difluoro-2-phosphanylacetic acid;4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carboxylic acid.
| Compound Name | 2,2-difluoro-2-phosphanylacetic acid;4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 143138142 |
| Molecular Formula | C22H17F2N2O4PS |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 2,2-difluoro-2-phosphanylacetic acid;4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carboxylic acid |
| SMILES | O=C(O)C(F)(F)P.O=C(O)c1cc2c(Nc3ccc(-c4ccccc4)cc3)cncc2s1 |
| InChI | InChI=1S/C20H14N2O2S.C2H3F2O2P/c23-20(24)18-10-16-17(11-21-12-19(16)25-18)22-15-8-6-14(7-9-15)13-4-2-1-3-5-13;3-2(4,7)1(5)6/h1-12,22H,(H,23,24);7H2,(H,5,6) |
| InChIKey | NSOIJKSYDOEKDI-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|