C14H22O2 — CID 143139124
ethane;3-[(1Z)-3-methoxybuta-1,3-dienyl]-2-methylcyclohex-2-en-1-one (PubChem CID 143139124) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is ethane;3-[(1Z)-3-methoxybuta-1,3-dienyl]-2-methylcyclohex-2-en-1-one.
| Compound Name | ethane;3-[(1Z)-3-methoxybuta-1,3-dienyl]-2-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 143139124 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | ethane;3-[(1Z)-3-methoxybuta-1,3-dienyl]-2-methylcyclohex-2-en-1-one |
| SMILES | C=C(/C=C\C1=C(C)C(=O)CCC1)OC.CC |
| InChI | InChI=1S/C12H16O2.C2H6/c1-9(14-3)7-8-11-5-4-6-12(13)10(11)2;1-2/h7-8H,1,4-6H2,2-3H3;1-2H3/b8-7-; |
| InChIKey | DVOYUDUZMWIRTD-CFYXSCKTSA-N |
| XLogP | 3.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|