C20H28N2OS — CID 143139983
ethane;(4Z)-4-[[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]methylidene]-1,2-dihydroquinolin-3-one;methanethiol (PubChem CID 143139983) has the molecular formula C20H28N2OS and a molecular weight of 344.52 g/mol. Its IUPAC name is ethane;(4Z)-4-[[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]methylidene]-1,2-dihydroquinolin-3-one;methanethiol.
| Compound Name | ethane;(4Z)-4-[[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]methylidene]-1,2-dihydroquinolin-3-one;methanethiol |
|---|---|
| PubChem CID | 143139983 |
| Molecular Formula | C20H28N2OS |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | ethane;(4Z)-4-[[[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]methylidene]-1,2-dihydroquinolin-3-one;methanethiol |
| SMILES | C=C/C=C(\C=C/C)N/C=C1\C(=O)CNc2ccccc21.CC.CS |
| InChI | InChI=1S/C17H18N2O.C2H6.CH4S/c1-3-7-13(8-4-2)18-11-15-14-9-5-6-10-16(14)19-12-17(15)20;2*1-2/h3-11,18-19H,1,12H2,2H3;1-2H3;2H,1H3/b8-4-,13-7+,15-11-;; |
| InChIKey | FNYKKZWRLOTJKX-PNSCPNILSA-N |
| XLogP | 4.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|