C34H47NO — CID 143140047
4-(2,5-dimethylphenyl)-5-methylhexa-1,4-dien-2-amine;(3Z,5Z)-4-ethylhepta-1,3,5-triene;1-(4-ethylphenyl)ethenol (PubChem CID 143140047) has the molecular formula C34H47NO and a molecular weight of 485.76 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-5-methylhexa-1,4-dien-2-amine;(3Z,5Z)-4-ethylhepta-1,3,5-triene;1-(4-ethylphenyl)ethenol.
| Compound Name | 4-(2,5-dimethylphenyl)-5-methylhexa-1,4-dien-2-amine;(3Z,5Z)-4-ethylhepta-1,3,5-triene;1-(4-ethylphenyl)ethenol |
|---|---|
| PubChem CID | 143140047 |
| Molecular Formula | C34H47NO |
| Molecular Weight | 485.76 g/mol |
| Exact Mass | 485.37 |
| IUPAC Name | 4-(2,5-dimethylphenyl)-5-methylhexa-1,4-dien-2-amine;(3Z,5Z)-4-ethylhepta-1,3,5-triene;1-(4-ethylphenyl)ethenol |
| SMILES | C=C(N)CC(=C(C)C)c1cc(C)ccc1C.C=C(O)c1ccc(CC)cc1.C=C/C=C(\C=C/C)CC |
| InChI | InChI=1S/C15H21N.C10H12O.C9H14/c1-10(2)14(9-13(5)16)15-8-11(3)6-7-12(15)4;1-3-9-4-6-10(7-5-9)8(2)11;1-4-7-9(6-3)8-5-2/h6-8H,5,9,16H2,1-4H3;4-7,11H,2-3H2,1H3;4-5,7-8H,1,6H2,2-3H3/b;;8-5-,9-7- |
| InChIKey | LFFJFNKAOBCIQG-HLBVTYLMSA-N |
| XLogP | 9.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.76 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|