C20H43N — CID 143140739
ethane;1-methyl-3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[b]pyrrole;octane (PubChem CID 143140739) has the molecular formula C20H43N and a molecular weight of 297.57 g/mol. Its IUPAC name is ethane;1-methyl-3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[b]pyrrole;octane.
| Compound Name | ethane;1-methyl-3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[b]pyrrole;octane |
|---|---|
| PubChem CID | 143140739 |
| Molecular Formula | C20H43N |
| Molecular Weight | 297.57 g/mol |
| Exact Mass | 297.34 |
| IUPAC Name | ethane;1-methyl-3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[b]pyrrole;octane |
| SMILES | CC.CCCCCCCC.CN1CCC2CCCCCC21 |
| InChI | InChI=1S/C10H19N.C8H18.C2H6/c1-11-8-7-9-5-3-2-4-6-10(9)11;1-3-5-7-8-6-4-2;1-2/h9-10H,2-8H2,1H3;3-8H2,1-2H3;1-2H3 |
| InChIKey | VXHUPWXBIMGJTJ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.57 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|