About 8-[(Z)-but-1-enyl]-6,7-dimethyl-6-azaspiro[3.4]oct-7-ene;ethane
8-[(Z)-but-1-enyl]-6,7-dimethyl-6-azaspiro[3.4]oct-7-ene;ethane (PubChem CID 143140853) has the molecular formula C17H33N
and a molecular weight of 251.46 g/mol. Its IUPAC name is 8-[(Z)-but-1-enyl]-6,7-dimethyl-6-azaspiro[3.4]oct-7-ene;ethane.
Molecular Properties
| Compound Name | 8-[(Z)-but-1-enyl]-6,7-dimethyl-6-azaspiro[3.4]oct-7-ene;ethane |
| PubChem CID | 143140853 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | 8-[(Z)-but-1-enyl]-6,7-dimethyl-6-azaspiro[3.4]oct-7-ene;ethane |
| SMILES | CC.CC.CC/C=C\C1=C(C)N(C)CC12CCC2 |
| InChI | InChI=1S/C13H21N.2C2H6/c1-4-5-7-12-11(2)14(3)10-13(12)8-6-9-13;2*1-2/h5,7H,4,6,8-10H2,1-3H3;2*1-2H3/b7-5-;; |
| InChIKey | NHXVQPKJBNNSPU-MWKZNRQPSA-N |
| XLogP | 5.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-[(Z)-but-1-enyl]-6,7-dimethyl-6-azaspiro[3.4]oct-7-ene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(Z)-but-1-enyl]-6,7-dimethyl-6-azaspiro[3.4]oct-7-ene;ethane?
The IUPAC name of 8-[(Z)-but-1-enyl]-6,7-dimethyl-6-azaspiro[3.4]oct-7-ene;ethane (CID 143140853) is 8-[(Z)-but-1-enyl]-6,7-dimethyl-6-azaspiro[3.4]oct-7-ene;ethane.
What is the SMILES notation for 8-[(Z)-but-1-enyl]-6,7-dimethyl-6-azaspiro[3.4]oct-7-ene;ethane?
The canonical SMILES for 8-[(Z)-but-1-enyl]-6,7-dimethyl-6-azaspiro[3.4]oct-7-ene;ethane is CC.CC.CC/C=C\C1=C(C)N(C)CC12CCC2.
What is the InChIKey of 8-[(Z)-but-1-enyl]-6,7-dimethyl-6-azaspiro[3.4]oct-7-ene;ethane?
The InChIKey is NHXVQPKJBNNSPU-MWKZNRQPSA-N. The full InChI is InChI=1S/C13H21N.2C2H6/c1-4-5-7-12-11(2)14(3)10-13(12)8-6-9-13;2*1-2/h5,7H,4,6,8-10H2,1-3H3;2*1-2H3/b7-5-;;.
What are the key properties of 8-[(Z)-but-1-enyl]-6,7-dimethyl-6-azaspiro[3.4]oct-7-ene;ethane?
8-[(Z)-but-1-enyl]-6,7-dimethyl-6-azaspiro[3.4]oct-7-ene;ethane has a molecular weight of 251.46 g/mol, XLogP of 5.39, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(Z)-but-1-enyl]-6,7-dimethyl-6-azaspiro[3.4]oct-7-ene;ethane is sourced from PubChem (CID 143140853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).