C13H13ClN2O — CID 143141375
(2-amino-5-chlorophenyl)-(5-methyl-1,2-dihydropyridin-4-yl)methanone (PubChem CID 143141375) has the molecular formula C13H13ClN2O and a molecular weight of 248.71 g/mol. Its IUPAC name is (2-amino-5-chlorophenyl)-(5-methyl-1,2-dihydropyridin-4-yl)methanone.
| Compound Name | (2-amino-5-chlorophenyl)-(5-methyl-1,2-dihydropyridin-4-yl)methanone |
|---|---|
| PubChem CID | 143141375 |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (2-amino-5-chlorophenyl)-(5-methyl-1,2-dihydropyridin-4-yl)methanone |
| SMILES | CC1=CNCC=C1C(=O)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C13H13ClN2O/c1-8-7-16-5-4-10(8)13(17)11-6-9(14)2-3-12(11)15/h2-4,6-7,16H,5,15H2,1H3 |
| InChIKey | FMKSOHNNSQADAU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|