About [(2E,4Z)-2-ethenylhexa-2,4-dienyl]-trimethylazanium
[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-trimethylazanium (PubChem CID 143141441) has the molecular formula C11H20N+
and a molecular weight of 166.29 g/mol. Its IUPAC name is [(2E,4Z)-2-ethenylhexa-2,4-dienyl]-trimethylazanium.
Molecular Properties
| Compound Name | [(2E,4Z)-2-ethenylhexa-2,4-dienyl]-trimethylazanium |
| PubChem CID | 143141441 |
| Molecular Formula | C11H20N+ |
| Molecular Weight | 166.29 g/mol |
| Exact Mass | 166.16 |
| IUPAC Name | [(2E,4Z)-2-ethenylhexa-2,4-dienyl]-trimethylazanium |
| SMILES | C=C/C(=C\C=C/C)C[N+](C)(C)C |
| InChI | InChI=1S/C11H20N/c1-6-8-9-11(7-2)10-12(3,4)5/h6-9H,2,10H2,1,3-5H3/q+1/b8-6-,11-9+ |
| InChIKey | WWOFQTJZBWOXRL-ZOEDNYEGSA-N |
| XLogP | 2.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(2E,4Z)-2-ethenylhexa-2,4-dienyl]-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E,4Z)-2-ethenylhexa-2,4-dienyl]-trimethylazanium?
The IUPAC name of [(2E,4Z)-2-ethenylhexa-2,4-dienyl]-trimethylazanium (CID 143141441) is [(2E,4Z)-2-ethenylhexa-2,4-dienyl]-trimethylazanium.
What is the SMILES notation for [(2E,4Z)-2-ethenylhexa-2,4-dienyl]-trimethylazanium?
The canonical SMILES for [(2E,4Z)-2-ethenylhexa-2,4-dienyl]-trimethylazanium is C=C/C(=C\C=C/C)C[N+](C)(C)C.
What is the InChIKey of [(2E,4Z)-2-ethenylhexa-2,4-dienyl]-trimethylazanium?
The InChIKey is WWOFQTJZBWOXRL-ZOEDNYEGSA-N. The full InChI is InChI=1S/C11H20N/c1-6-8-9-11(7-2)10-12(3,4)5/h6-9H,2,10H2,1,3-5H3/q+1/b8-6-,11-9+.
What are the key properties of [(2E,4Z)-2-ethenylhexa-2,4-dienyl]-trimethylazanium?
[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-trimethylazanium has a molecular weight of 166.29 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E,4Z)-2-ethenylhexa-2,4-dienyl]-trimethylazanium is sourced from PubChem (CID 143141441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).