C15H17FN2 — CID 143141754
13-fluoro-2,4,6-trimethyl-6,9-diazatetracyclo[8.4.0.02,4.05,9]tetradeca-1(10),7,11,13-tetraene (PubChem CID 143141754) has the molecular formula C15H17FN2 and a molecular weight of 244.31 g/mol. Its IUPAC name is 13-fluoro-2,4,6-trimethyl-6,9-diazatetracyclo[8.4.0.02,4.05,9]tetradeca-1(10),7,11,13-tetraene.
| Compound Name | 13-fluoro-2,4,6-trimethyl-6,9-diazatetracyclo[8.4.0.02,4.05,9]tetradeca-1(10),7,11,13-tetraene |
|---|---|
| PubChem CID | 143141754 |
| Molecular Formula | C15H17FN2 |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 13-fluoro-2,4,6-trimethyl-6,9-diazatetracyclo[8.4.0.02,4.05,9]tetradeca-1(10),7,11,13-tetraene |
| SMILES | CN1C=CN2c3ccc(F)cc3C3(C)CC3(C)C12 |
| InChI | InChI=1S/C15H17FN2/c1-14-9-15(14,2)13-17(3)6-7-18(13)12-5-4-10(16)8-11(12)14/h4-8,13H,9H2,1-3H3 |
| InChIKey | ZZHHDMNPXVFTAU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |