About ethane;3-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]-2,5-dihydropyrrole
ethane;3-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]-2,5-dihydropyrrole (PubChem CID 143141932) has the molecular formula C14H27N
and a molecular weight of 209.38 g/mol. Its IUPAC name is ethane;3-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | ethane;3-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]-2,5-dihydropyrrole |
| PubChem CID | 143141932 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | ethane;3-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]-2,5-dihydropyrrole |
| SMILES | C=CC1=C(/C=C\C)CN(C)C1.CC.CC |
| InChI | InChI=1S/C10H15N.2C2H6/c1-4-6-10-8-11(3)7-9(10)5-2;2*1-2/h4-6H,2,7-8H2,1,3H3;2*1-2H3/b6-4-;; |
| InChIKey | GURHWUPLMIMCBO-XFUGJFOESA-N |
| XLogP | 4.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;3-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]-2,5-dihydropyrrole?
The IUPAC name of ethane;3-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]-2,5-dihydropyrrole (CID 143141932) is ethane;3-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]-2,5-dihydropyrrole.
What is the SMILES notation for ethane;3-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]-2,5-dihydropyrrole?
The canonical SMILES for ethane;3-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]-2,5-dihydropyrrole is C=CC1=C(/C=C\C)CN(C)C1.CC.CC.
What is the InChIKey of ethane;3-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]-2,5-dihydropyrrole?
The InChIKey is GURHWUPLMIMCBO-XFUGJFOESA-N. The full InChI is InChI=1S/C10H15N.2C2H6/c1-4-6-10-8-11(3)7-9(10)5-2;2*1-2/h4-6H,2,7-8H2,1,3H3;2*1-2H3/b6-4-;;.
What are the key properties of ethane;3-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]-2,5-dihydropyrrole?
ethane;3-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]-2,5-dihydropyrrole has a molecular weight of 209.38 g/mol, XLogP of 4.04, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]-2,5-dihydropyrrole is sourced from PubChem (CID 143141932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).