C14H37N3OS2 — CID 143142022
ethane;sulfane;1-N,2-N,3,3-tetramethyl-1-N-[methyl(propan-2-yl)amino]sulfanyloxybutane-1,2-diamine (PubChem CID 143142022) has the molecular formula C14H37N3OS2 and a molecular weight of 327.60 g/mol. Its IUPAC name is ethane;sulfane;1-N,2-N,3,3-tetramethyl-1-N-[methyl(propan-2-yl)amino]sulfanyloxybutane-1,2-diamine.
| Compound Name | ethane;sulfane;1-N,2-N,3,3-tetramethyl-1-N-[methyl(propan-2-yl)amino]sulfanyloxybutane-1,2-diamine |
|---|---|
| PubChem CID | 143142022 |
| Molecular Formula | C14H37N3OS2 |
| Molecular Weight | 327.60 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | ethane;sulfane;1-N,2-N,3,3-tetramethyl-1-N-[methyl(propan-2-yl)amino]sulfanyloxybutane-1,2-diamine |
| SMILES | CC.CNC(CN(C)OSN(C)C(C)C)C(C)(C)C.S |
| InChI | InChI=1S/C12H29N3OS.C2H6.H2S/c1-10(2)15(8)17-16-14(7)9-11(13-6)12(3,4)5;1-2;/h10-11,13H,9H2,1-8H3;1-2H3;1H2 |
| InChIKey | UMZBXNVTBWGNQF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.60 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|