C8H15NO — CID 143142276
(3E,5Z)-6-aminohexa-1,3,5-trien-3-ol;ethane (PubChem CID 143142276) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is (3E,5Z)-6-aminohexa-1,3,5-trien-3-ol;ethane.
| Compound Name | (3E,5Z)-6-aminohexa-1,3,5-trien-3-ol;ethane |
|---|---|
| PubChem CID | 143142276 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (3E,5Z)-6-aminohexa-1,3,5-trien-3-ol;ethane |
| SMILES | C=C/C(O)=C\C=C/N.CC |
| InChI | InChI=1S/C6H9NO.C2H6/c1-2-6(8)4-3-5-7;1-2/h2-5,8H,1,7H2;1-2H3/b5-3-,6-4+; |
| InChIKey | NAKRPAKDMUGQKX-HQWJOSOMSA-N |
| XLogP | 2.11 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|