About ethane;N-methyl-2,3-dihydro-1,3-benzothiazol-6-amine
ethane;N-methyl-2,3-dihydro-1,3-benzothiazol-6-amine (PubChem CID 143142470) has the molecular formula C10H16N2S
and a molecular weight of 196.32 g/mol. Its IUPAC name is ethane;N-methyl-2,3-dihydro-1,3-benzothiazol-6-amine.
Molecular Properties
| Compound Name | ethane;N-methyl-2,3-dihydro-1,3-benzothiazol-6-amine |
| PubChem CID | 143142470 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | ethane;N-methyl-2,3-dihydro-1,3-benzothiazol-6-amine |
| SMILES | CC.CNc1ccc2c(c1)SCN2 |
| InChI | InChI=1S/C8H10N2S.C2H6/c1-9-6-2-3-7-8(4-6)11-5-10-7;1-2/h2-4,9-10H,5H2,1H3;1-2H3 |
| InChIKey | MLHQJTKFBZSWBM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;N-methyl-2,3-dihydro-1,3-benzothiazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-2,3-dihydro-1,3-benzothiazol-6-amine?
The IUPAC name of ethane;N-methyl-2,3-dihydro-1,3-benzothiazol-6-amine (CID 143142470) is ethane;N-methyl-2,3-dihydro-1,3-benzothiazol-6-amine.
What is the SMILES notation for ethane;N-methyl-2,3-dihydro-1,3-benzothiazol-6-amine?
The canonical SMILES for ethane;N-methyl-2,3-dihydro-1,3-benzothiazol-6-amine is CC.CNc1ccc2c(c1)SCN2.
What is the InChIKey of ethane;N-methyl-2,3-dihydro-1,3-benzothiazol-6-amine?
The InChIKey is MLHQJTKFBZSWBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2S.C2H6/c1-9-6-2-3-7-8(4-6)11-5-10-7;1-2/h2-4,9-10H,5H2,1H3;1-2H3.
What are the key properties of ethane;N-methyl-2,3-dihydro-1,3-benzothiazol-6-amine?
ethane;N-methyl-2,3-dihydro-1,3-benzothiazol-6-amine has a molecular weight of 196.32 g/mol, XLogP of 3.23, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-2,3-dihydro-1,3-benzothiazol-6-amine is sourced from PubChem (CID 143142470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).