C11H14N4 — CID 143142507
N,7-diethylpyrido[3,4-b]pyrazin-3-amine (PubChem CID 143142507) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is N,7-diethylpyrido[3,4-b]pyrazin-3-amine.
| Compound Name | N,7-diethylpyrido[3,4-b]pyrazin-3-amine |
|---|---|
| PubChem CID | 143142507 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | N,7-diethylpyrido[3,4-b]pyrazin-3-amine |
| SMILES | CCNc1cnc2cc(CC)ncc2n1 |
| InChI | InChI=1S/C11H14N4/c1-3-8-5-9-10(6-13-8)15-11(7-14-9)12-4-2/h5-7H,3-4H2,1-2H3,(H,12,15) |
| InChIKey | XEEQNWZYJVTVCR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |