methyl-[3-(methylamino)propyl]phosphinous acid

C5H14NOP — CID 143142651

IUPACmethyl-[3-(methylamino)propyl]phosphinous acid
SMILESCNCCCP(C)O
InChIInChI=1S/C5H14NOP/c1-6-4-3-5-8(2)7/h6-7H,3-5H2,1-2H3
InChIKeyFLEBZCVPLLQSPF-UHFFFAOYSA-N
MW135.15 g/mol
LogP0.61
Rot. Bonds4

About methyl-[3-(methylamino)propyl]phosphinous acid

methyl-[3-(methylamino)propyl]phosphinous acid (PubChem CID 143142651) has the molecular formula C5H14NOP and a molecular weight of 135.15 g/mol. Its IUPAC name is methyl-[3-(methylamino)propyl]phosphinous acid.

Molecular Properties

Compound Namemethyl-[3-(methylamino)propyl]phosphinous acid
PubChem CID143142651
Molecular FormulaC5H14NOP
Molecular Weight135.15 g/mol
Exact Mass135.08
IUPAC Namemethyl-[3-(methylamino)propyl]phosphinous acid
SMILESCNCCCP(C)O
InChIInChI=1S/C5H14NOP/c1-6-4-3-5-8(2)7/h6-7H,3-5H2,1-2H3
InChIKeyFLEBZCVPLLQSPF-UHFFFAOYSA-N
XLogP0.61
TPSA32.26 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500135.15
LogP ≤ 50.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze methyl-[3-(methylamino)propyl]phosphinous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl-[3-(methylamino)propyl]phosphinous acid?
The IUPAC name of methyl-[3-(methylamino)propyl]phosphinous acid (CID 143142651) is methyl-[3-(methylamino)propyl]phosphinous acid.
What is the SMILES notation for methyl-[3-(methylamino)propyl]phosphinous acid?
The canonical SMILES for methyl-[3-(methylamino)propyl]phosphinous acid is CNCCCP(C)O.
What is the InChIKey of methyl-[3-(methylamino)propyl]phosphinous acid?
The InChIKey is FLEBZCVPLLQSPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14NOP/c1-6-4-3-5-8(2)7/h6-7H,3-5H2,1-2H3.
What are the key properties of methyl-[3-(methylamino)propyl]phosphinous acid?
methyl-[3-(methylamino)propyl]phosphinous acid has a molecular weight of 135.15 g/mol, XLogP of 0.61, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[3-(methylamino)propyl]phosphinous acid is sourced from PubChem (CID 143142651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).