C16H29N — CID 143142655
ethane;4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-1-methylpiperidine (PubChem CID 143142655) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is ethane;4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-1-methylpiperidine.
| Compound Name | ethane;4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-1-methylpiperidine |
|---|---|
| PubChem CID | 143142655 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | ethane;4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-1-methylpiperidine |
| SMILES | C=C/C(=C\C=C/C)CC1CCN(C)CC1.CC |
| InChI | InChI=1S/C14H23N.C2H6/c1-4-6-7-13(5-2)12-14-8-10-15(3)11-9-14;1-2/h4-7,14H,2,8-12H2,1,3H3;1-2H3/b6-4-,13-7+; |
| InChIKey | VLXAHKLHZWNRMH-ZJPWNLOHSA-N |
| XLogP | 4.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|