C33H56 — CID 143142669
(3aR,5aR,5bR,7aS,9R,11aR,11bR,13aR)-9-(4,4-dimethyl-2-methylidenepentyl)-3a,5a,5b,7a-tetramethyl-2,3,4,5,6,7,8,9,10,11,11a,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene (PubChem CID 143142669) has the molecular formula C33H56 and a molecular weight of 452.81 g/mol. Its IUPAC name is (3aR,5aR,5bR,7aS,9R,11aR,11bR,13aR)-9-(4,4-dimethyl-2-methylidenepentyl)-3a,5a,5b,7a-tetramethyl-2,3,4,5,6,7,8,9,10,11,11a,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene.
| Compound Name | (3aR,5aR,5bR,7aS,9R,11aR,11bR,13aR)-9-(4,4-dimethyl-2-methylidenepentyl)-3a,5a,5b,7a-tetramethyl-2,3,4,5,6,7,8,9,10,11,11a,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene |
|---|---|
| PubChem CID | 143142669 |
| Molecular Formula | C33H56 |
| Molecular Weight | 452.81 g/mol |
| Exact Mass | 452.44 |
| IUPAC Name | (3aR,5aR,5bR,7aS,9R,11aR,11bR,13aR)-9-(4,4-dimethyl-2-methylidenepentyl)-3a,5a,5b,7a-tetramethyl-2,3,4,5,6,7,8,9,10,11,11a,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene |
| SMILES | C=C(C[C@H]1CC[C@@H]2[C@H]3CC[C@@H]4C5CCC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@]2(C)C1)CC(C)(C)C |
| InChI | InChI=1S/C33H56/c1-23(21-29(2,3)4)20-24-11-12-26-28-14-13-27-25-10-9-15-30(25,5)16-18-32(27,7)33(28,8)19-17-31(26,6)22-24/h24-28H,1,9-22H2,2-8H3/t24-,25?,26-,27-,28-,30-,31+,32-,33-/m1/s1 |
| InChIKey | GKLNDTABVZAMOP-WVWAKUEXSA-N |
| XLogP | 10.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.81 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|