C40H50N2O — CID 143142783
3-[[4-[(4Z)-4-(cyclohexa-1,5-dien-1-ylmethylideneamino)-5-methylhepta-4,6-dienyl]phenyl]methyl]-7-(2-ethylphenyl)-2-methylidene-5-oxoheptanenitrile;ethane (PubChem CID 143142783) has the molecular formula C40H50N2O and a molecular weight of 574.85 g/mol. Its IUPAC name is 3-[[4-[(4Z)-4-(cyclohexa-1,5-dien-1-ylmethylideneamino)-5-methylhepta-4,6-dienyl]phenyl]methyl]-7-(2-ethylphenyl)-2-methylidene-5-oxoheptanenitrile;ethane.
| Compound Name | 3-[[4-[(4Z)-4-(cyclohexa-1,5-dien-1-ylmethylideneamino)-5-methylhepta-4,6-dienyl]phenyl]methyl]-7-(2-ethylphenyl)-2-methylidene-5-oxoheptanenitrile;ethane |
|---|---|
| PubChem CID | 143142783 |
| Molecular Formula | C40H50N2O |
| Molecular Weight | 574.85 g/mol |
| Exact Mass | 574.39 |
| IUPAC Name | 3-[[4-[(4Z)-4-(cyclohexa-1,5-dien-1-ylmethylideneamino)-5-methylhepta-4,6-dienyl]phenyl]methyl]-7-(2-ethylphenyl)-2-methylidene-5-oxoheptanenitrile;ethane |
| SMILES | C=C/C(C)=C(CCCc1ccc(CC(CC(=O)CCc2ccccc2CC)C(=C)C#N)cc1)\N=C\C1=CCCC=C1.CC |
| InChI | InChI=1S/C38H44N2O.C2H6/c1-5-29(3)38(40-28-33-13-8-7-9-14-33)18-12-15-31-19-21-32(22-20-31)25-36(30(4)27-39)26-37(41)24-23-35-17-11-10-16-34(35)6-2;1-2/h5,8,10-11,13-14,16-17,19-22,28,36H,1,4,6-7,9,12,15,18,23-26H2,2-3H3;1-2H3/b38-29-,40-28+; |
| InChIKey | IKCSCMXBGWDMTB-MDXBIQJASA-N |
| XLogP | 10.24 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.85 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|