About (2R)-3-aminooxane-2,5-diol
(2R)-3-aminooxane-2,5-diol (PubChem CID 143143228) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is (2R)-3-aminooxane-2,5-diol.
Molecular Properties
| Compound Name | (2R)-3-aminooxane-2,5-diol |
| PubChem CID | 143143228 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | (2R)-3-aminooxane-2,5-diol |
| SMILES | NC1CC(O)CO[C@H]1O |
| InChI | InChI=1S/C5H11NO3/c6-4-1-3(7)2-9-5(4)8/h3-5,7-8H,1-2,6H2/t3?,4?,5-/m1/s1 |
| InChIKey | QQEYFXOFAWQOQK-ZAGMFXPOSA-N |
| XLogP | -1.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-3-aminooxane-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-aminooxane-2,5-diol?
The IUPAC name of (2R)-3-aminooxane-2,5-diol (CID 143143228) is (2R)-3-aminooxane-2,5-diol.
What is the SMILES notation for (2R)-3-aminooxane-2,5-diol?
The canonical SMILES for (2R)-3-aminooxane-2,5-diol is NC1CC(O)CO[C@H]1O.
What is the InChIKey of (2R)-3-aminooxane-2,5-diol?
The InChIKey is QQEYFXOFAWQOQK-ZAGMFXPOSA-N. The full InChI is InChI=1S/C5H11NO3/c6-4-1-3(7)2-9-5(4)8/h3-5,7-8H,1-2,6H2/t3?,4?,5-/m1/s1.
What are the key properties of (2R)-3-aminooxane-2,5-diol?
(2R)-3-aminooxane-2,5-diol has a molecular weight of 133.15 g/mol, XLogP of -1.59, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-aminooxane-2,5-diol is sourced from PubChem (CID 143143228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).