C17H14O4 — CID 14314340
4,9-dihydroxyspiro[cyclopenta[b]naphthalene-2,1'-cyclopentane]-1,3-dione (PubChem CID 14314340) has the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. Its IUPAC name is 4,9-dihydroxyspiro[cyclopenta[b]naphthalene-2,1'-cyclopentane]-1,3-dione.
| Compound Name | 4,9-dihydroxyspiro[cyclopenta[b]naphthalene-2,1'-cyclopentane]-1,3-dione |
|---|---|
| PubChem CID | 14314340 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4,9-dihydroxyspiro[cyclopenta[b]naphthalene-2,1'-cyclopentane]-1,3-dione |
| SMILES | O=C1c2c(c(O)c3ccccc3c2O)C(=O)C12CCCC2 |
| InChI | InChI=1S/C17H14O4/c18-13-9-5-1-2-6-10(9)14(19)12-11(13)15(20)17(16(12)21)7-3-4-8-17/h1-2,5-6,18-19H,3-4,7-8H2 |
| InChIKey | NZDDRJVEAKAJKD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|