C17H34N8 — CID 143143449
2-N-[3-(ethylamino)propyl]-6-(4-ethylpiperazin-1-yl)-4-N-propyl-1,3,5-triazine-2,4-diamine (PubChem CID 143143449) has the molecular formula C17H34N8 and a molecular weight of 350.52 g/mol. Its IUPAC name is 2-N-[3-(ethylamino)propyl]-6-(4-ethylpiperazin-1-yl)-4-N-propyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[3-(ethylamino)propyl]-6-(4-ethylpiperazin-1-yl)-4-N-propyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 143143449 |
| Molecular Formula | C17H34N8 |
| Molecular Weight | 350.52 g/mol |
| Exact Mass | 350.29 |
| IUPAC Name | 2-N-[3-(ethylamino)propyl]-6-(4-ethylpiperazin-1-yl)-4-N-propyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCNc1nc(NCCCNCC)nc(N2CCN(CC)CC2)n1 |
| InChI | InChI=1S/C17H34N8/c1-4-8-19-15-21-16(20-10-7-9-18-5-2)23-17(22-15)25-13-11-24(6-3)12-14-25/h18H,4-14H2,1-3H3,(H2,19,20,21,22,23) |
| InChIKey | FKHZDPDTPQKTGP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.52 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|